C15H15F2NO5 — CID 8673348
[2-[[4-(difluoromethoxy)benzoyl]amino]-2-oxoethyl] (E)-pent-2-enoate (PubChem CID 8673348) has the molecular formula C15H15F2NO5 and a molecular weight of 327.28 g/mol. Its IUPAC name is [2-[[4-(difluoromethoxy)benzoyl]amino]-2-oxoethyl] (E)-pent-2-enoate.
| Compound Name | [2-[[4-(difluoromethoxy)benzoyl]amino]-2-oxoethyl] (E)-pent-2-enoate |
|---|---|
| PubChem CID | 8673348 |
| Molecular Formula | C15H15F2NO5 |
| Molecular Weight | 327.28 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | [2-[[4-(difluoromethoxy)benzoyl]amino]-2-oxoethyl] (E)-pent-2-enoate |
| SMILES | CC/C=C/C(=O)OCC(=O)NC(=O)c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C15H15F2NO5/c1-2-3-4-13(20)22-9-12(19)18-14(21)10-5-7-11(8-6-10)23-15(16)17/h3-8,15H,2,9H2,1H3,(H,18,19,21)/b4-3+ |
| InChIKey | OILPEEYZBDVMAQ-ONEGZZNKSA-N |
| XLogP | 2.05 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.28 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|