C17H13F2NO6 — CID 7790075
[2-[[4-(difluoromethoxy)benzoyl]amino]-2-oxoethyl] 3-hydroxybenzoate (PubChem CID 7790075) has the molecular formula C17H13F2NO6 and a molecular weight of 365.29 g/mol. Its IUPAC name is [2-[[4-(difluoromethoxy)benzoyl]amino]-2-oxoethyl] 3-hydroxybenzoate.
| Compound Name | [2-[[4-(difluoromethoxy)benzoyl]amino]-2-oxoethyl] 3-hydroxybenzoate |
|---|---|
| PubChem CID | 7790075 |
| Molecular Formula | C17H13F2NO6 |
| Molecular Weight | 365.29 g/mol |
| Exact Mass | 365.07 |
| IUPAC Name | [2-[[4-(difluoromethoxy)benzoyl]amino]-2-oxoethyl] 3-hydroxybenzoate |
| SMILES | O=C(COC(=O)c1cccc(O)c1)NC(=O)c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C17H13F2NO6/c18-17(19)26-13-6-4-10(5-7-13)15(23)20-14(22)9-25-16(24)11-2-1-3-12(21)8-11/h1-8,17,21H,9H2,(H,20,22,23) |
| InChIKey | VYWJFXUQCNUJEI-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.29 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |