C23H20F2N2O7 — CID 42970777
[2-[[4-(difluoromethoxy)benzoyl]amino]-2-oxoethyl] 2-butyl-1,3-dioxoisoindole-5-carboxylate (PubChem CID 42970777) has the molecular formula C23H20F2N2O7 and a molecular weight of 474.42 g/mol. Its IUPAC name is [2-[[4-(difluoromethoxy)benzoyl]amino]-2-oxoethyl] 2-butyl-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | [2-[[4-(difluoromethoxy)benzoyl]amino]-2-oxoethyl] 2-butyl-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 42970777 |
| Molecular Formula | C23H20F2N2O7 |
| Molecular Weight | 474.42 g/mol |
| Exact Mass | 474.12 |
| IUPAC Name | [2-[[4-(difluoromethoxy)benzoyl]amino]-2-oxoethyl] 2-butyl-1,3-dioxoisoindole-5-carboxylate |
| SMILES | CCCCN1C(=O)c2ccc(C(=O)OCC(=O)NC(=O)c3ccc(OC(F)F)cc3)cc2C1=O |
| InChI | InChI=1S/C23H20F2N2O7/c1-2-3-10-27-20(30)16-9-6-14(11-17(16)21(27)31)22(32)33-12-18(28)26-19(29)13-4-7-15(8-5-13)34-23(24)25/h4-9,11,23H,2-3,10,12H2,1H3,(H,26,28,29) |
| InChIKey | CAPPOCDCCIRGGL-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.42 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|