C20H18N2O7S — CID 55355976
[2-oxo-2-(thiophene-2-carbonylamino)ethyl] 2-(3-methoxypropyl)-1,3-dioxoisoindole-5-carboxylate (PubChem CID 55355976) has the molecular formula C20H18N2O7S and a molecular weight of 430.44 g/mol. Its IUPAC name is [2-oxo-2-(thiophene-2-carbonylamino)ethyl] 2-(3-methoxypropyl)-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | [2-oxo-2-(thiophene-2-carbonylamino)ethyl] 2-(3-methoxypropyl)-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 55355976 |
| Molecular Formula | C20H18N2O7S |
| Molecular Weight | 430.44 g/mol |
| Exact Mass | 430.08 |
| IUPAC Name | [2-oxo-2-(thiophene-2-carbonylamino)ethyl] 2-(3-methoxypropyl)-1,3-dioxoisoindole-5-carboxylate |
| SMILES | COCCCN1C(=O)c2ccc(C(=O)OCC(=O)NC(=O)c3cccs3)cc2C1=O |
| InChI | InChI=1S/C20H18N2O7S/c1-28-8-3-7-22-18(25)13-6-5-12(10-14(13)19(22)26)20(27)29-11-16(23)21-17(24)15-4-2-9-30-15/h2,4-6,9-10H,3,7-8,11H2,1H3,(H,21,23,24) |
| InChIKey | LRMDKKJTNMZCQS-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.44 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|