C14H17F2NO4 — CID 2693137
[2-(tert-butylamino)-2-oxoethyl] 3-(difluoromethoxy)benzoate (PubChem CID 2693137) has the molecular formula C14H17F2NO4 and a molecular weight of 301.29 g/mol. Its IUPAC name is [2-(tert-butylamino)-2-oxoethyl] 3-(difluoromethoxy)benzoate.
| Compound Name | [2-(tert-butylamino)-2-oxoethyl] 3-(difluoromethoxy)benzoate |
|---|---|
| PubChem CID | 2693137 |
| Molecular Formula | C14H17F2NO4 |
| Molecular Weight | 301.29 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | [2-(tert-butylamino)-2-oxoethyl] 3-(difluoromethoxy)benzoate |
| SMILES | CC(C)(C)NC(=O)COC(=O)c1cccc(OC(F)F)c1 |
| InChI | InChI=1S/C14H17F2NO4/c1-14(2,3)17-11(18)8-20-12(19)9-5-4-6-10(7-9)21-13(15)16/h4-7,13H,8H2,1-3H3,(H,17,18) |
| InChIKey | YVIXEWMDFHYOMJ-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.29 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |