C17H19NO3 — CID 2507385
[2-(tert-butylamino)-2-oxoethyl] naphthalene-2-carboxylate (PubChem CID 2507385) has the molecular formula C17H19NO3 and a molecular weight of 285.34 g/mol. Its IUPAC name is [2-(tert-butylamino)-2-oxoethyl] naphthalene-2-carboxylate.
| Compound Name | [2-(tert-butylamino)-2-oxoethyl] naphthalene-2-carboxylate |
|---|---|
| PubChem CID | 2507385 |
| Molecular Formula | C17H19NO3 |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.14 |
| IUPAC Name | [2-(tert-butylamino)-2-oxoethyl] naphthalene-2-carboxylate |
| SMILES | CC(C)(C)NC(=O)COC(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C17H19NO3/c1-17(2,3)18-15(19)11-21-16(20)14-9-8-12-6-4-5-7-13(12)10-14/h4-10H,11H2,1-3H3,(H,18,19) |
| InChIKey | GFDRYJCUFHCQEF-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |