C15H14N2O4 — CID 2507436
[2-(methylcarbamoylamino)-2-oxoethyl] naphthalene-2-carboxylate (PubChem CID 2507436) has the molecular formula C15H14N2O4 and a molecular weight of 286.29 g/mol. Its IUPAC name is [2-(methylcarbamoylamino)-2-oxoethyl] naphthalene-2-carboxylate.
| Compound Name | [2-(methylcarbamoylamino)-2-oxoethyl] naphthalene-2-carboxylate |
|---|---|
| PubChem CID | 2507436 |
| Molecular Formula | C15H14N2O4 |
| Molecular Weight | 286.29 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | [2-(methylcarbamoylamino)-2-oxoethyl] naphthalene-2-carboxylate |
| SMILES | CNC(=O)NC(=O)COC(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C15H14N2O4/c1-16-15(20)17-13(18)9-21-14(19)12-7-6-10-4-2-3-5-11(10)8-12/h2-8H,9H2,1H3,(H2,16,17,18,20) |
| InChIKey | DWPIKPUCAWYPLP-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.29 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |