C11H11BrN2O4 — CID 2625657
[2-(methylcarbamoylamino)-2-oxoethyl] 4-bromobenzoate (PubChem CID 2625657) has the molecular formula C11H11BrN2O4 and a molecular weight of 315.12 g/mol. Its IUPAC name is [2-(methylcarbamoylamino)-2-oxoethyl] 4-bromobenzoate.
| Compound Name | [2-(methylcarbamoylamino)-2-oxoethyl] 4-bromobenzoate |
|---|---|
| PubChem CID | 2625657 |
| Molecular Formula | C11H11BrN2O4 |
| Molecular Weight | 315.12 g/mol |
| Exact Mass | 313.99 |
| IUPAC Name | [2-(methylcarbamoylamino)-2-oxoethyl] 4-bromobenzoate |
| SMILES | CNC(=O)NC(=O)COC(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C11H11BrN2O4/c1-13-11(17)14-9(15)6-18-10(16)7-2-4-8(12)5-3-7/h2-5H,6H2,1H3,(H2,13,14,15,17) |
| InChIKey | KBTCYTGGEXCVMA-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.12 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |