C11H13N3O4 — CID 30344335
[2-(methylcarbamoylamino)-2-oxoethyl] 6-methylpyridine-3-carboxylate (PubChem CID 30344335) has the molecular formula C11H13N3O4 and a molecular weight of 251.24 g/mol. Its IUPAC name is [2-(methylcarbamoylamino)-2-oxoethyl] 6-methylpyridine-3-carboxylate.
| Compound Name | [2-(methylcarbamoylamino)-2-oxoethyl] 6-methylpyridine-3-carboxylate |
|---|---|
| PubChem CID | 30344335 |
| Molecular Formula | C11H13N3O4 |
| Molecular Weight | 251.24 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | [2-(methylcarbamoylamino)-2-oxoethyl] 6-methylpyridine-3-carboxylate |
| SMILES | CNC(=O)NC(=O)COC(=O)c1ccc(C)nc1 |
| InChI | InChI=1S/C11H13N3O4/c1-7-3-4-8(5-13-7)10(16)18-6-9(15)14-11(17)12-2/h3-5H,6H2,1-2H3,(H2,12,14,15,17) |
| InChIKey | NGCAGODQTSJDBG-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.24 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |