C15H20N2O6 — CID 2561800
[2-(methylcarbamoylamino)-2-oxoethyl] 3,4-diethoxybenzoate (PubChem CID 2561800) has the molecular formula C15H20N2O6 and a molecular weight of 324.33 g/mol. Its IUPAC name is [2-(methylcarbamoylamino)-2-oxoethyl] 3,4-diethoxybenzoate.
| Compound Name | [2-(methylcarbamoylamino)-2-oxoethyl] 3,4-diethoxybenzoate |
|---|---|
| PubChem CID | 2561800 |
| Molecular Formula | C15H20N2O6 |
| Molecular Weight | 324.33 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | [2-(methylcarbamoylamino)-2-oxoethyl] 3,4-diethoxybenzoate |
| SMILES | CCOc1ccc(C(=O)OCC(=O)NC(=O)NC)cc1OCC |
| InChI | InChI=1S/C15H20N2O6/c1-4-21-11-7-6-10(8-12(11)22-5-2)14(19)23-9-13(18)17-15(20)16-3/h6-8H,4-5,9H2,1-3H3,(H2,16,17,18,20) |
| InChIKey | ZCPAJCONHPEZIZ-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.33 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |