C24H32N2O6 — CID 16527888
[2-(1-adamantylcarbamoylamino)-2-oxoethyl] 3,4-diethoxybenzoate (PubChem CID 16527888) has the molecular formula C24H32N2O6 and a molecular weight of 444.53 g/mol. Its IUPAC name is [2-(1-adamantylcarbamoylamino)-2-oxoethyl] 3,4-diethoxybenzoate.
| Compound Name | [2-(1-adamantylcarbamoylamino)-2-oxoethyl] 3,4-diethoxybenzoate |
|---|---|
| PubChem CID | 16527888 |
| Molecular Formula | C24H32N2O6 |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.23 |
| IUPAC Name | [2-(1-adamantylcarbamoylamino)-2-oxoethyl] 3,4-diethoxybenzoate |
| SMILES | CCOc1ccc(C(=O)OCC(=O)NC(=O)NC23CC4CC(CC(C4)C2)C3)cc1OCC |
| InChI | InChI=1S/C24H32N2O6/c1-3-30-19-6-5-18(10-20(19)31-4-2)22(28)32-14-21(27)25-23(29)26-24-11-15-7-16(12-24)9-17(8-15)13-24/h5-6,10,15-17H,3-4,7-9,11-14H2,1-2H3,(H2,25,26,27,29) |
| InChIKey | ACELNIMEIYYMII-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |