C23H31NO5 — CID 7903408
[2-(1-adamantylmethylamino)-2-oxoethyl] 3-ethoxy-4-methoxybenzoate (PubChem CID 7903408) has the molecular formula C23H31NO5 and a molecular weight of 401.50 g/mol. Its IUPAC name is [2-(1-adamantylmethylamino)-2-oxoethyl] 3-ethoxy-4-methoxybenzoate.
| Compound Name | [2-(1-adamantylmethylamino)-2-oxoethyl] 3-ethoxy-4-methoxybenzoate |
|---|---|
| PubChem CID | 7903408 |
| Molecular Formula | C23H31NO5 |
| Molecular Weight | 401.50 g/mol |
| Exact Mass | 401.22 |
| IUPAC Name | [2-(1-adamantylmethylamino)-2-oxoethyl] 3-ethoxy-4-methoxybenzoate |
| SMILES | CCOc1cc(C(=O)OCC(=O)NCC23CC4CC(CC(C4)C2)C3)ccc1OC |
| InChI | InChI=1S/C23H31NO5/c1-3-28-20-9-18(4-5-19(20)27-2)22(26)29-13-21(25)24-14-23-10-15-6-16(11-23)8-17(7-15)12-23/h4-5,9,15-17H,3,6-8,10-14H2,1-2H3,(H,24,25) |
| InChIKey | ARABFXVBDKBGCV-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.50 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |