C22H27F2NO5 — CID 7712234
[2-(1-adamantylamino)-2-oxoethyl] 4-(difluoromethoxy)-3-ethoxybenzoate (PubChem CID 7712234) has the molecular formula C22H27F2NO5 and a molecular weight of 423.46 g/mol. Its IUPAC name is [2-(1-adamantylamino)-2-oxoethyl] 4-(difluoromethoxy)-3-ethoxybenzoate.
| Compound Name | [2-(1-adamantylamino)-2-oxoethyl] 4-(difluoromethoxy)-3-ethoxybenzoate |
|---|---|
| PubChem CID | 7712234 |
| Molecular Formula | C22H27F2NO5 |
| Molecular Weight | 423.46 g/mol |
| Exact Mass | 423.19 |
| IUPAC Name | [2-(1-adamantylamino)-2-oxoethyl] 4-(difluoromethoxy)-3-ethoxybenzoate |
| SMILES | CCOc1cc(C(=O)OCC(=O)NC23CC4CC(CC(C4)C2)C3)ccc1OC(F)F |
| InChI | InChI=1S/C22H27F2NO5/c1-2-28-18-8-16(3-4-17(18)30-21(23)24)20(27)29-12-19(26)25-22-9-13-5-14(10-22)7-15(6-13)11-22/h3-4,8,13-15,21H,2,5-7,9-12H2,1H3,(H,25,26) |
| InChIKey | FRXUAFLWFVJCCI-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.46 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |