C15H19F2NO5 — CID 7712119
[2-oxo-2-(propan-2-ylamino)ethyl] 4-(difluoromethoxy)-3-ethoxybenzoate (PubChem CID 7712119) has the molecular formula C15H19F2NO5 and a molecular weight of 331.32 g/mol. Its IUPAC name is [2-oxo-2-(propan-2-ylamino)ethyl] 4-(difluoromethoxy)-3-ethoxybenzoate.
| Compound Name | [2-oxo-2-(propan-2-ylamino)ethyl] 4-(difluoromethoxy)-3-ethoxybenzoate |
|---|---|
| PubChem CID | 7712119 |
| Molecular Formula | C15H19F2NO5 |
| Molecular Weight | 331.32 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | [2-oxo-2-(propan-2-ylamino)ethyl] 4-(difluoromethoxy)-3-ethoxybenzoate |
| SMILES | CCOc1cc(C(=O)OCC(=O)NC(C)C)ccc1OC(F)F |
| InChI | InChI=1S/C15H19F2NO5/c1-4-21-12-7-10(5-6-11(12)23-15(16)17)14(20)22-8-13(19)18-9(2)3/h5-7,9,15H,4,8H2,1-3H3,(H,18,19) |
| InChIKey | MSANFDMNZLFGCZ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.32 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |