C22H28ClNO5 — CID 7359024
[2-(1-adamantylmethylamino)-2-oxoethyl] 3-chloro-5-ethoxy-4-hydroxybenzoate (PubChem CID 7359024) has the molecular formula C22H28ClNO5 and a molecular weight of 421.92 g/mol. Its IUPAC name is [2-(1-adamantylmethylamino)-2-oxoethyl] 3-chloro-5-ethoxy-4-hydroxybenzoate.
| Compound Name | [2-(1-adamantylmethylamino)-2-oxoethyl] 3-chloro-5-ethoxy-4-hydroxybenzoate |
|---|---|
| PubChem CID | 7359024 |
| Molecular Formula | C22H28ClNO5 |
| Molecular Weight | 421.92 g/mol |
| Exact Mass | 421.17 |
| IUPAC Name | [2-(1-adamantylmethylamino)-2-oxoethyl] 3-chloro-5-ethoxy-4-hydroxybenzoate |
| SMILES | CCOc1cc(C(=O)OCC(=O)NCC23CC4CC(CC(C4)C2)C3)cc(Cl)c1O |
| InChI | InChI=1S/C22H28ClNO5/c1-2-28-18-7-16(6-17(23)20(18)26)21(27)29-11-19(25)24-12-22-8-13-3-14(9-22)5-15(4-13)10-22/h6-7,13-15,26H,2-5,8-12H2,1H3,(H,24,25) |
| InChIKey | HDFSZYSUQRWAFF-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.92 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |