C26H29NO4 — CID 7859627
[2-(1-adamantylmethylamino)-2-oxoethyl] 4-phenoxybenzoate (PubChem CID 7859627) has the molecular formula C26H29NO4 and a molecular weight of 419.52 g/mol. Its IUPAC name is [2-(1-adamantylmethylamino)-2-oxoethyl] 4-phenoxybenzoate.
| Compound Name | [2-(1-adamantylmethylamino)-2-oxoethyl] 4-phenoxybenzoate |
|---|---|
| PubChem CID | 7859627 |
| Molecular Formula | C26H29NO4 |
| Molecular Weight | 419.52 g/mol |
| Exact Mass | 419.21 |
| IUPAC Name | [2-(1-adamantylmethylamino)-2-oxoethyl] 4-phenoxybenzoate |
| SMILES | O=C(COC(=O)c1ccc(Oc2ccccc2)cc1)NCC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C26H29NO4/c28-24(27-17-26-13-18-10-19(14-26)12-20(11-18)15-26)16-30-25(29)21-6-8-23(9-7-21)31-22-4-2-1-3-5-22/h1-9,18-20H,10-17H2,(H,27,28) |
| InChIKey | OQZWVSGIXIEDTP-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.52 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |