C18H24N2O3 — CID 8550624
[2-(1-adamantylmethylamino)-2-oxoethyl] 1H-pyrrole-2-carboxylate (PubChem CID 8550624) has the molecular formula C18H24N2O3 and a molecular weight of 316.40 g/mol. Its IUPAC name is [2-(1-adamantylmethylamino)-2-oxoethyl] 1H-pyrrole-2-carboxylate.
| Compound Name | [2-(1-adamantylmethylamino)-2-oxoethyl] 1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 8550624 |
| Molecular Formula | C18H24N2O3 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | [2-(1-adamantylmethylamino)-2-oxoethyl] 1H-pyrrole-2-carboxylate |
| SMILES | O=C(COC(=O)c1ccc[nH]1)NCC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C18H24N2O3/c21-16(10-23-17(22)15-2-1-3-19-15)20-11-18-7-12-4-13(8-18)6-14(5-12)9-18/h1-3,12-14,19H,4-11H2,(H,20,21) |
| InChIKey | BRLIHBHRGCJZAS-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |