C22H26N2O4 — CID 8549131
[2-[1-adamantyl(furan-2-ylmethyl)amino]-2-oxoethyl] 1H-pyrrole-2-carboxylate (PubChem CID 8549131) has the molecular formula C22H26N2O4 and a molecular weight of 382.46 g/mol. Its IUPAC name is [2-[1-adamantyl(furan-2-ylmethyl)amino]-2-oxoethyl] 1H-pyrrole-2-carboxylate.
| Compound Name | [2-[1-adamantyl(furan-2-ylmethyl)amino]-2-oxoethyl] 1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 8549131 |
| Molecular Formula | C22H26N2O4 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | [2-[1-adamantyl(furan-2-ylmethyl)amino]-2-oxoethyl] 1H-pyrrole-2-carboxylate |
| SMILES | O=C(OCC(=O)N(Cc1ccco1)C12CC3CC(CC(C3)C1)C2)c1ccc[nH]1 |
| InChI | InChI=1S/C22H26N2O4/c25-20(14-28-21(26)19-4-1-5-23-19)24(13-18-3-2-6-27-18)22-10-15-7-16(11-22)9-17(8-15)12-22/h1-6,15-17,23H,7-14H2 |
| InChIKey | DFQYZENWXAJHNS-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 75.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |