C24H27FN2O3 — CID 7704846
N-(1-adamantyl)-2-[(Z)-(3-fluorophenyl)methylideneamino]oxy-N-(furan-2-ylmethyl)acetamide (PubChem CID 7704846) has the molecular formula C24H27FN2O3 and a molecular weight of 410.49 g/mol. Its IUPAC name is N-(1-adamantyl)-2-[(Z)-(3-fluorophenyl)methylideneamino]oxy-N-(furan-2-ylmethyl)acetamide.
| Compound Name | N-(1-adamantyl)-2-[(Z)-(3-fluorophenyl)methylideneamino]oxy-N-(furan-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 7704846 |
| Molecular Formula | C24H27FN2O3 |
| Molecular Weight | 410.49 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | N-(1-adamantyl)-2-[(Z)-(3-fluorophenyl)methylideneamino]oxy-N-(furan-2-ylmethyl)acetamide |
| SMILES | O=C(CO/N=C\c1cccc(F)c1)N(Cc1ccco1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C24H27FN2O3/c25-21-4-1-3-17(10-21)14-26-30-16-23(28)27(15-22-5-2-6-29-22)24-11-18-7-19(12-24)9-20(8-18)13-24/h1-6,10,14,18-20H,7-9,11-13,15-16H2/b26-14- |
| InChIKey | VKZFMSWQLILMQG-WGARJPEWSA-N |
| XLogP | 4.77 |
| TPSA | 55.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.49 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|