C23H20FN3O3 — CID 7704833
2-[(Z)-(3-fluorophenyl)methylideneamino]oxy-1-[(3S)-3-(furan-2-yl)-5-(4-methylphenyl)-3,4-dihydropyrazol-2-yl]ethanone (PubChem CID 7704833) has the molecular formula C23H20FN3O3 and a molecular weight of 405.43 g/mol. Its IUPAC name is 2-[(Z)-(3-fluorophenyl)methylideneamino]oxy-1-[(3S)-3-(furan-2-yl)-5-(4-methylphenyl)-3,4-dihydropyrazol-2-yl]ethanone.
| Compound Name | 2-[(Z)-(3-fluorophenyl)methylideneamino]oxy-1-[(3S)-3-(furan-2-yl)-5-(4-methylphenyl)-3,4-dihydropyrazol-2-yl]ethanone |
|---|---|
| PubChem CID | 7704833 |
| Molecular Formula | C23H20FN3O3 |
| Molecular Weight | 405.43 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | 2-[(Z)-(3-fluorophenyl)methylideneamino]oxy-1-[(3S)-3-(furan-2-yl)-5-(4-methylphenyl)-3,4-dihydropyrazol-2-yl]ethanone |
| SMILES | Cc1ccc(C2=NN(C(=O)CO/N=C\c3cccc(F)c3)[C@H](c3ccco3)C2)cc1 |
| InChI | InChI=1S/C23H20FN3O3/c1-16-7-9-18(10-8-16)20-13-21(22-6-3-11-29-22)27(26-20)23(28)15-30-25-14-17-4-2-5-19(24)12-17/h2-12,14,21H,13,15H2,1H3/b25-14-/t21-/m0/s1 |
| InChIKey | UUQSWJQZCVWAEI-RWFYVVHNSA-N |
| XLogP | 4.46 |
| TPSA | 67.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.43 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|