C24H23N3O4 — CID 7919124
1-[(3R)-3-(furan-2-yl)-5-(4-methoxyphenyl)-3,4-dihydropyrazol-2-yl]-2-[(Z)-(2-methylphenyl)methylideneamino]oxyethanone (PubChem CID 7919124) has the molecular formula C24H23N3O4 and a molecular weight of 417.47 g/mol. Its IUPAC name is 1-[(3R)-3-(furan-2-yl)-5-(4-methoxyphenyl)-3,4-dihydropyrazol-2-yl]-2-[(Z)-(2-methylphenyl)methylideneamino]oxyethanone.
| Compound Name | 1-[(3R)-3-(furan-2-yl)-5-(4-methoxyphenyl)-3,4-dihydropyrazol-2-yl]-2-[(Z)-(2-methylphenyl)methylideneamino]oxyethanone |
|---|---|
| PubChem CID | 7919124 |
| Molecular Formula | C24H23N3O4 |
| Molecular Weight | 417.47 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | 1-[(3R)-3-(furan-2-yl)-5-(4-methoxyphenyl)-3,4-dihydropyrazol-2-yl]-2-[(Z)-(2-methylphenyl)methylideneamino]oxyethanone |
| SMILES | COc1ccc(C2=NN(C(=O)CO/N=C\c3ccccc3C)[C@@H](c3ccco3)C2)cc1 |
| InChI | InChI=1S/C24H23N3O4/c1-17-6-3-4-7-19(17)15-25-31-16-24(28)27-22(23-8-5-13-30-23)14-21(26-27)18-9-11-20(29-2)12-10-18/h3-13,15,22H,14,16H2,1-2H3/b25-15-/t22-/m1/s1 |
| InChIKey | JJAUEMVBPIHBFM-OOEUXUOGSA-N |
| XLogP | 4.33 |
| TPSA | 76.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.47 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|