C21H23FO3 — CID 92964577
[2-(1-adamantyl)-2-oxoethyl] (Z)-3-(3-fluorophenyl)prop-2-enoate (PubChem CID 92964577) has the molecular formula C21H23FO3 and a molecular weight of 342.41 g/mol. Its IUPAC name is [2-(1-adamantyl)-2-oxoethyl] (Z)-3-(3-fluorophenyl)prop-2-enoate.
| Compound Name | [2-(1-adamantyl)-2-oxoethyl] (Z)-3-(3-fluorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 92964577 |
| Molecular Formula | C21H23FO3 |
| Molecular Weight | 342.41 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | [2-(1-adamantyl)-2-oxoethyl] (Z)-3-(3-fluorophenyl)prop-2-enoate |
| SMILES | O=C(/C=C\c1cccc(F)c1)OCC(=O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C21H23FO3/c22-18-3-1-2-14(9-18)4-5-20(24)25-13-19(23)21-10-15-6-16(11-21)8-17(7-15)12-21/h1-5,9,15-17H,6-8,10-13H2/b5-4- |
| InChIKey | IXCBRRZDRNLYMO-PLNGDYQASA-N |
| XLogP | 4.17 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.41 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|