C12H12FNO3 — CID 3394995
[2-(methylamino)-2-oxoethyl] 3-(3-fluorophenyl)prop-2-enoate (PubChem CID 3394995) has the molecular formula C12H12FNO3 and a molecular weight of 237.23 g/mol. Its IUPAC name is [2-(methylamino)-2-oxoethyl] 3-(3-fluorophenyl)prop-2-enoate.
| Compound Name | [2-(methylamino)-2-oxoethyl] 3-(3-fluorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 3394995 |
| Molecular Formula | C12H12FNO3 |
| Molecular Weight | 237.23 g/mol |
| Exact Mass | 237.08 |
| IUPAC Name | [2-(methylamino)-2-oxoethyl] 3-(3-fluorophenyl)prop-2-enoate |
| SMILES | CNC(=O)COC(=O)C=Cc1cccc(F)c1 |
| InChI | InChI=1S/C12H12FNO3/c1-14-11(15)8-17-12(16)6-5-9-3-2-4-10(13)7-9/h2-7H,8H2,1H3,(H,14,15) |
| InChIKey | BKOSSBKXKAROMD-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.23 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|