C19H17ClFNO3 — CID 7786184
[2-[[(1R)-1-(3-chlorophenyl)ethyl]amino]-2-oxoethyl] (E)-3-(3-fluorophenyl)prop-2-enoate (PubChem CID 7786184) has the molecular formula C19H17ClFNO3 and a molecular weight of 361.80 g/mol. Its IUPAC name is [2-[[(1R)-1-(3-chlorophenyl)ethyl]amino]-2-oxoethyl] (E)-3-(3-fluorophenyl)prop-2-enoate.
| Compound Name | [2-[[(1R)-1-(3-chlorophenyl)ethyl]amino]-2-oxoethyl] (E)-3-(3-fluorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7786184 |
| Molecular Formula | C19H17ClFNO3 |
| Molecular Weight | 361.80 g/mol |
| Exact Mass | 361.09 |
| IUPAC Name | [2-[[(1R)-1-(3-chlorophenyl)ethyl]amino]-2-oxoethyl] (E)-3-(3-fluorophenyl)prop-2-enoate |
| SMILES | C[C@@H](NC(=O)COC(=O)/C=C/c1cccc(F)c1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C19H17ClFNO3/c1-13(15-5-3-6-16(20)11-15)22-18(23)12-25-19(24)9-8-14-4-2-7-17(21)10-14/h2-11,13H,12H2,1H3,(H,22,23)/b9-8+/t13-/m1/s1 |
| InChIKey | WAMHUWLUEWJGHU-MMQHEFTJSA-N |
| XLogP | 3.91 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.80 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|