C22H23F3O3 — CID 7355445
[2-(1-adamantyl)-2-oxoethyl] (E)-3-[4-(trifluoromethyl)phenyl]prop-2-enoate (PubChem CID 7355445) has the molecular formula C22H23F3O3 and a molecular weight of 392.42 g/mol. Its IUPAC name is [2-(1-adamantyl)-2-oxoethyl] (E)-3-[4-(trifluoromethyl)phenyl]prop-2-enoate.
| Compound Name | [2-(1-adamantyl)-2-oxoethyl] (E)-3-[4-(trifluoromethyl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 7355445 |
| Molecular Formula | C22H23F3O3 |
| Molecular Weight | 392.42 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | [2-(1-adamantyl)-2-oxoethyl] (E)-3-[4-(trifluoromethyl)phenyl]prop-2-enoate |
| SMILES | O=C(/C=C/c1ccc(C(F)(F)F)cc1)OCC(=O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C22H23F3O3/c23-22(24,25)18-4-1-14(2-5-18)3-6-20(27)28-13-19(26)21-10-15-7-16(11-21)9-17(8-15)12-21/h1-6,15-17H,7-13H2/b6-3+ |
| InChIKey | BAFVOSGNQAZYMQ-ZZXKWVIFSA-N |
| XLogP | 5.05 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.42 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|