C21H23F3O2 — CID 5353022
1-adamantylmethyl (E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoate (PubChem CID 5353022) has the molecular formula C21H23F3O2 and a molecular weight of 364.41 g/mol. Its IUPAC name is 1-adamantylmethyl (E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoate.
| Compound Name | 1-adamantylmethyl (E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 5353022 |
| Molecular Formula | C21H23F3O2 |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | 1-adamantylmethyl (E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoate |
| SMILES | O=C(/C=C/c1cccc(C(F)(F)F)c1)OCC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C21H23F3O2/c22-21(23,24)18-3-1-2-14(9-18)4-5-19(25)26-13-20-10-15-6-16(11-20)8-17(7-15)12-20/h1-5,9,15-17H,6-8,10-13H2/b5-4+ |
| InChIKey | ANIWTKAOBMFSNQ-SNAWJCMRSA-N |
| XLogP | 5.48 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|