C24H16F3NO3S — CID 5217629
(2-oxo-2-phenothiazin-10-ylethyl) 3-[3-(trifluoromethyl)phenyl]prop-2-enoate (PubChem CID 5217629) has the molecular formula C24H16F3NO3S and a molecular weight of 455.46 g/mol. Its IUPAC name is (2-oxo-2-phenothiazin-10-ylethyl) 3-[3-(trifluoromethyl)phenyl]prop-2-enoate.
| Compound Name | (2-oxo-2-phenothiazin-10-ylethyl) 3-[3-(trifluoromethyl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 5217629 |
| Molecular Formula | C24H16F3NO3S |
| Molecular Weight | 455.46 g/mol |
| Exact Mass | 455.08 |
| IUPAC Name | (2-oxo-2-phenothiazin-10-ylethyl) 3-[3-(trifluoromethyl)phenyl]prop-2-enoate |
| SMILES | O=C(C=Cc1cccc(C(F)(F)F)c1)OCC(=O)N1c2ccccc2Sc2ccccc21 |
| InChI | InChI=1S/C24H16F3NO3S/c25-24(26,27)17-7-5-6-16(14-17)12-13-23(30)31-15-22(29)28-18-8-1-3-10-20(18)32-21-11-4-2-9-19(21)28/h1-14H,15H2 |
| InChIKey | NNXWELSNJVLNKE-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.46 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|