C17H19F3N2O5S — CID 46650663
[2-(4-methylsulfonylpiperazin-1-yl)-2-oxoethyl] (E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoate (PubChem CID 46650663) has the molecular formula C17H19F3N2O5S and a molecular weight of 420.41 g/mol. Its IUPAC name is [2-(4-methylsulfonylpiperazin-1-yl)-2-oxoethyl] (E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoate.
| Compound Name | [2-(4-methylsulfonylpiperazin-1-yl)-2-oxoethyl] (E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 46650663 |
| Molecular Formula | C17H19F3N2O5S |
| Molecular Weight | 420.41 g/mol |
| Exact Mass | 420.10 |
| IUPAC Name | [2-(4-methylsulfonylpiperazin-1-yl)-2-oxoethyl] (E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoate |
| SMILES | CS(=O)(=O)N1CCN(C(=O)COC(=O)/C=C/c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C17H19F3N2O5S/c1-28(25,26)22-9-7-21(8-10-22)15(23)12-27-16(24)6-5-13-3-2-4-14(11-13)17(18,19)20/h2-6,11H,7-10,12H2,1H3/b6-5+ |
| InChIKey | BVWPFEIADWZYPF-AATRIKPKSA-N |
| XLogP | 1.37 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.41 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|