C22H20ClF3N2O3 — CID 55397103
[2-[4-(3-chlorophenyl)piperazin-1-yl]-2-oxoethyl] (E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoate (PubChem CID 55397103) has the molecular formula C22H20ClF3N2O3 and a molecular weight of 452.86 g/mol. Its IUPAC name is [2-[4-(3-chlorophenyl)piperazin-1-yl]-2-oxoethyl] (E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoate.
| Compound Name | [2-[4-(3-chlorophenyl)piperazin-1-yl]-2-oxoethyl] (E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 55397103 |
| Molecular Formula | C22H20ClF3N2O3 |
| Molecular Weight | 452.86 g/mol |
| Exact Mass | 452.11 |
| IUPAC Name | [2-[4-(3-chlorophenyl)piperazin-1-yl]-2-oxoethyl] (E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoate |
| SMILES | O=C(/C=C/c1cccc(C(F)(F)F)c1)OCC(=O)N1CCN(c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C22H20ClF3N2O3/c23-18-5-2-6-19(14-18)27-9-11-28(12-10-27)20(29)15-31-21(30)8-7-16-3-1-4-17(13-16)22(24,25)26/h1-8,13-14H,9-12,15H2/b8-7+ |
| InChIKey | FRGXGYYXCGOTKY-BQYQJAHWSA-N |
| XLogP | 4.26 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.86 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|