C17H11Cl2F3O2 — CID 3560338
(2,6-dichlorophenyl)methyl 3-[3-(trifluoromethyl)phenyl]prop-2-enoate (PubChem CID 3560338) has the molecular formula C17H11Cl2F3O2 and a molecular weight of 375.17 g/mol. Its IUPAC name is (2,6-dichlorophenyl)methyl 3-[3-(trifluoromethyl)phenyl]prop-2-enoate.
| Compound Name | (2,6-dichlorophenyl)methyl 3-[3-(trifluoromethyl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 3560338 |
| Molecular Formula | C17H11Cl2F3O2 |
| Molecular Weight | 375.17 g/mol |
| Exact Mass | 374.01 |
| IUPAC Name | (2,6-dichlorophenyl)methyl 3-[3-(trifluoromethyl)phenyl]prop-2-enoate |
| SMILES | O=C(C=Cc1cccc(C(F)(F)F)c1)OCc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C17H11Cl2F3O2/c18-14-5-2-6-15(19)13(14)10-24-16(23)8-7-11-3-1-4-12(9-11)17(20,21)22/h1-9H,10H2 |
| InChIKey | JFADZDOFTIVKLY-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.17 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|