C20H17ClF3NO3 — CID 7764744
[2-[[(1S)-1-(2-chlorophenyl)ethyl]amino]-2-oxoethyl] (E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoate (PubChem CID 7764744) has the molecular formula C20H17ClF3NO3 and a molecular weight of 411.81 g/mol. Its IUPAC name is [2-[[(1S)-1-(2-chlorophenyl)ethyl]amino]-2-oxoethyl] (E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoate.
| Compound Name | [2-[[(1S)-1-(2-chlorophenyl)ethyl]amino]-2-oxoethyl] (E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 7764744 |
| Molecular Formula | C20H17ClF3NO3 |
| Molecular Weight | 411.81 g/mol |
| Exact Mass | 411.08 |
| IUPAC Name | [2-[[(1S)-1-(2-chlorophenyl)ethyl]amino]-2-oxoethyl] (E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoate |
| SMILES | C[C@H](NC(=O)COC(=O)/C=C/c1cccc(C(F)(F)F)c1)c1ccccc1Cl |
| InChI | InChI=1S/C20H17ClF3NO3/c1-13(16-7-2-3-8-17(16)21)25-18(26)12-28-19(27)10-9-14-5-4-6-15(11-14)20(22,23)24/h2-11,13H,12H2,1H3,(H,25,26)/b10-9+/t13-/m0/s1 |
| InChIKey | GCNADBUJPNHMHE-LXKVQUBZSA-N |
| XLogP | 4.79 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.81 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|