C20H18ClF3N2O5S — CID 4046360
[2-[4-chloro-3-(dimethylsulfamoyl)anilino]-2-oxoethyl] 3-[3-(trifluoromethyl)phenyl]prop-2-enoate (PubChem CID 4046360) has the molecular formula C20H18ClF3N2O5S and a molecular weight of 490.89 g/mol. Its IUPAC name is [2-[4-chloro-3-(dimethylsulfamoyl)anilino]-2-oxoethyl] 3-[3-(trifluoromethyl)phenyl]prop-2-enoate.
| Compound Name | [2-[4-chloro-3-(dimethylsulfamoyl)anilino]-2-oxoethyl] 3-[3-(trifluoromethyl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 4046360 |
| Molecular Formula | C20H18ClF3N2O5S |
| Molecular Weight | 490.89 g/mol |
| Exact Mass | 490.06 |
| IUPAC Name | [2-[4-chloro-3-(dimethylsulfamoyl)anilino]-2-oxoethyl] 3-[3-(trifluoromethyl)phenyl]prop-2-enoate |
| SMILES | CN(C)S(=O)(=O)c1cc(NC(=O)COC(=O)C=Cc2cccc(C(F)(F)F)c2)ccc1Cl |
| InChI | InChI=1S/C20H18ClF3N2O5S/c1-26(2)32(29,30)17-11-15(7-8-16(17)21)25-18(27)12-31-19(28)9-6-13-4-3-5-14(10-13)20(22,23)24/h3-11H,12H2,1-2H3,(H,25,27) |
| InChIKey | SJPYKTNUXLFEDJ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.89 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|