C18H12ClF3N2O5 — CID 29142782
[2-(4-chloro-3-nitroanilino)-2-oxoethyl] (E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoate (PubChem CID 29142782) has the molecular formula C18H12ClF3N2O5 and a molecular weight of 428.75 g/mol. Its IUPAC name is [2-(4-chloro-3-nitroanilino)-2-oxoethyl] (E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoate.
| Compound Name | [2-(4-chloro-3-nitroanilino)-2-oxoethyl] (E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 29142782 |
| Molecular Formula | C18H12ClF3N2O5 |
| Molecular Weight | 428.75 g/mol |
| Exact Mass | 428.04 |
| IUPAC Name | [2-(4-chloro-3-nitroanilino)-2-oxoethyl] (E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoate |
| SMILES | O=C(COC(=O)/C=C/c1cccc(C(F)(F)F)c1)Nc1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H12ClF3N2O5/c19-14-6-5-13(9-15(14)24(27)28)23-16(25)10-29-17(26)7-4-11-2-1-3-12(8-11)18(20,21)22/h1-9H,10H2,(H,23,25)/b7-4+ |
| InChIKey | KYTUDPNCFPAJQN-QPJJXVBHSA-N |
| XLogP | 4.46 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.75 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|