C17H16F3NO5S — CID 55730929
[5-(dimethylsulfamoyl)furan-2-yl]methyl (E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoate (PubChem CID 55730929) has the molecular formula C17H16F3NO5S and a molecular weight of 403.38 g/mol. Its IUPAC name is [5-(dimethylsulfamoyl)furan-2-yl]methyl (E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoate.
| Compound Name | [5-(dimethylsulfamoyl)furan-2-yl]methyl (E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 55730929 |
| Molecular Formula | C17H16F3NO5S |
| Molecular Weight | 403.38 g/mol |
| Exact Mass | 403.07 |
| IUPAC Name | [5-(dimethylsulfamoyl)furan-2-yl]methyl (E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoate |
| SMILES | CN(C)S(=O)(=O)c1ccc(COC(=O)/C=C/c2cccc(C(F)(F)F)c2)o1 |
| InChI | InChI=1S/C17H16F3NO5S/c1-21(2)27(23,24)16-9-7-14(26-16)11-25-15(22)8-6-12-4-3-5-13(10-12)17(18,19)20/h3-10H,11H2,1-2H3/b8-6+ |
| InChIKey | PGLDERBILSKLDO-SOFGYWHQSA-N |
| XLogP | 3.31 |
| TPSA | 76.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.38 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|