C19H23NO7S — CID 55730493
[5-(dimethylsulfamoyl)furan-2-yl]methyl (E)-3-(4-ethoxy-3-methoxyphenyl)prop-2-enoate (PubChem CID 55730493) has the molecular formula C19H23NO7S and a molecular weight of 409.46 g/mol. Its IUPAC name is [5-(dimethylsulfamoyl)furan-2-yl]methyl (E)-3-(4-ethoxy-3-methoxyphenyl)prop-2-enoate.
| Compound Name | [5-(dimethylsulfamoyl)furan-2-yl]methyl (E)-3-(4-ethoxy-3-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 55730493 |
| Molecular Formula | C19H23NO7S |
| Molecular Weight | 409.46 g/mol |
| Exact Mass | 409.12 |
| IUPAC Name | [5-(dimethylsulfamoyl)furan-2-yl]methyl (E)-3-(4-ethoxy-3-methoxyphenyl)prop-2-enoate |
| SMILES | CCOc1ccc(/C=C/C(=O)OCc2ccc(S(=O)(=O)N(C)C)o2)cc1OC |
| InChI | InChI=1S/C19H23NO7S/c1-5-25-16-9-6-14(12-17(16)24-4)7-10-18(21)26-13-15-8-11-19(27-15)28(22,23)20(2)3/h6-12H,5,13H2,1-4H3/b10-7+ |
| InChIKey | NSNPHQSBZWIDFM-JXMROGBWSA-N |
| XLogP | 2.69 |
| TPSA | 95.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.46 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|