C18H21NO8S — CID 55730700
[5-(dimethylsulfamoyl)furan-2-yl]methyl 2-(4-acetyl-2-methoxyphenoxy)acetate (PubChem CID 55730700) has the molecular formula C18H21NO8S and a molecular weight of 411.43 g/mol. Its IUPAC name is [5-(dimethylsulfamoyl)furan-2-yl]methyl 2-(4-acetyl-2-methoxyphenoxy)acetate.
| Compound Name | [5-(dimethylsulfamoyl)furan-2-yl]methyl 2-(4-acetyl-2-methoxyphenoxy)acetate |
|---|---|
| PubChem CID | 55730700 |
| Molecular Formula | C18H21NO8S |
| Molecular Weight | 411.43 g/mol |
| Exact Mass | 411.10 |
| IUPAC Name | [5-(dimethylsulfamoyl)furan-2-yl]methyl 2-(4-acetyl-2-methoxyphenoxy)acetate |
| SMILES | COc1cc(C(C)=O)ccc1OCC(=O)OCc1ccc(S(=O)(=O)N(C)C)o1 |
| InChI | InChI=1S/C18H21NO8S/c1-12(20)13-5-7-15(16(9-13)24-4)25-11-17(21)26-10-14-6-8-18(27-14)28(22,23)19(2)3/h5-9H,10-11H2,1-4H3 |
| InChIKey | STRDISVXCMWFTE-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 112.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.43 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |