C22H29NO7S — CID 55730465
[5-(dimethylsulfamoyl)furan-2-yl]methyl 4-oxo-4-(4-pentoxyphenyl)butanoate (PubChem CID 55730465) has the molecular formula C22H29NO7S and a molecular weight of 451.54 g/mol. Its IUPAC name is [5-(dimethylsulfamoyl)furan-2-yl]methyl 4-oxo-4-(4-pentoxyphenyl)butanoate.
| Compound Name | [5-(dimethylsulfamoyl)furan-2-yl]methyl 4-oxo-4-(4-pentoxyphenyl)butanoate |
|---|---|
| PubChem CID | 55730465 |
| Molecular Formula | C22H29NO7S |
| Molecular Weight | 451.54 g/mol |
| Exact Mass | 451.17 |
| IUPAC Name | [5-(dimethylsulfamoyl)furan-2-yl]methyl 4-oxo-4-(4-pentoxyphenyl)butanoate |
| SMILES | CCCCCOc1ccc(C(=O)CCC(=O)OCc2ccc(S(=O)(=O)N(C)C)o2)cc1 |
| InChI | InChI=1S/C22H29NO7S/c1-4-5-6-15-28-18-9-7-17(8-10-18)20(24)12-13-21(25)29-16-19-11-14-22(30-19)31(26,27)23(2)3/h7-11,14H,4-6,12-13,15-16H2,1-3H3 |
| InChIKey | BPHQGQLKSCIQFR-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 103.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.54 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|