C24H30N2O7S — CID 42981383
[2-oxo-2-[(4-sulfamoylphenyl)methylamino]ethyl] 4-oxo-4-(4-pentoxyphenyl)butanoate (PubChem CID 42981383) has the molecular formula C24H30N2O7S and a molecular weight of 490.58 g/mol. Its IUPAC name is [2-oxo-2-[(4-sulfamoylphenyl)methylamino]ethyl] 4-oxo-4-(4-pentoxyphenyl)butanoate.
| Compound Name | [2-oxo-2-[(4-sulfamoylphenyl)methylamino]ethyl] 4-oxo-4-(4-pentoxyphenyl)butanoate |
|---|---|
| PubChem CID | 42981383 |
| Molecular Formula | C24H30N2O7S |
| Molecular Weight | 490.58 g/mol |
| Exact Mass | 490.18 |
| IUPAC Name | [2-oxo-2-[(4-sulfamoylphenyl)methylamino]ethyl] 4-oxo-4-(4-pentoxyphenyl)butanoate |
| SMILES | CCCCCOc1ccc(C(=O)CCC(=O)OCC(=O)NCc2ccc(S(N)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C24H30N2O7S/c1-2-3-4-15-32-20-9-7-19(8-10-20)22(27)13-14-24(29)33-17-23(28)26-16-18-5-11-21(12-6-18)34(25,30)31/h5-12H,2-4,13-17H2,1H3,(H,26,28)(H2,25,30,31) |
| InChIKey | PDCHAXGCJKIVHY-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 141.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.58 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|