C21H26N2O6S — CID 42981381
[2-oxo-2-[(4-sulfamoylphenyl)methylamino]ethyl] 4-(3-methylbutoxy)benzoate (PubChem CID 42981381) has the molecular formula C21H26N2O6S and a molecular weight of 434.51 g/mol. Its IUPAC name is [2-oxo-2-[(4-sulfamoylphenyl)methylamino]ethyl] 4-(3-methylbutoxy)benzoate.
| Compound Name | [2-oxo-2-[(4-sulfamoylphenyl)methylamino]ethyl] 4-(3-methylbutoxy)benzoate |
|---|---|
| PubChem CID | 42981381 |
| Molecular Formula | C21H26N2O6S |
| Molecular Weight | 434.51 g/mol |
| Exact Mass | 434.15 |
| IUPAC Name | [2-oxo-2-[(4-sulfamoylphenyl)methylamino]ethyl] 4-(3-methylbutoxy)benzoate |
| SMILES | CC(C)CCOc1ccc(C(=O)OCC(=O)NCc2ccc(S(N)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C21H26N2O6S/c1-15(2)11-12-28-18-7-5-17(6-8-18)21(25)29-14-20(24)23-13-16-3-9-19(10-4-16)30(22,26)27/h3-10,15H,11-14H2,1-2H3,(H,23,24)(H2,22,26,27) |
| InChIKey | JZYYDFIJBHOZOH-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 124.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.51 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |