C18H20N2O5S — CID 2435086
2-(4-propanoylphenoxy)-N-[(4-sulfamoylphenyl)methyl]acetamide (PubChem CID 2435086) has the molecular formula C18H20N2O5S and a molecular weight of 376.43 g/mol. Its IUPAC name is 2-(4-propanoylphenoxy)-N-[(4-sulfamoylphenyl)methyl]acetamide.
| Compound Name | 2-(4-propanoylphenoxy)-N-[(4-sulfamoylphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 2435086 |
| Molecular Formula | C18H20N2O5S |
| Molecular Weight | 376.43 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | 2-(4-propanoylphenoxy)-N-[(4-sulfamoylphenyl)methyl]acetamide |
| SMILES | CCC(=O)c1ccc(OCC(=O)NCc2ccc(S(N)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C18H20N2O5S/c1-2-17(21)14-5-7-15(8-6-14)25-12-18(22)20-11-13-3-9-16(10-4-13)26(19,23)24/h3-10H,2,11-12H2,1H3,(H,20,22)(H2,19,23,24) |
| InChIKey | YETNUESJSHOGAK-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.43 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |