C24H24N2O7S — CID 42981356
[2-oxo-2-[(4-sulfamoylphenyl)methylamino]ethyl] 2-(4-phenylmethoxyphenoxy)acetate (PubChem CID 42981356) has the molecular formula C24H24N2O7S and a molecular weight of 484.53 g/mol. Its IUPAC name is [2-oxo-2-[(4-sulfamoylphenyl)methylamino]ethyl] 2-(4-phenylmethoxyphenoxy)acetate.
| Compound Name | [2-oxo-2-[(4-sulfamoylphenyl)methylamino]ethyl] 2-(4-phenylmethoxyphenoxy)acetate |
|---|---|
| PubChem CID | 42981356 |
| Molecular Formula | C24H24N2O7S |
| Molecular Weight | 484.53 g/mol |
| Exact Mass | 484.13 |
| IUPAC Name | [2-oxo-2-[(4-sulfamoylphenyl)methylamino]ethyl] 2-(4-phenylmethoxyphenoxy)acetate |
| SMILES | NS(=O)(=O)c1ccc(CNC(=O)COC(=O)COc2ccc(OCc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C24H24N2O7S/c25-34(29,30)22-12-6-18(7-13-22)14-26-23(27)16-33-24(28)17-32-21-10-8-20(9-11-21)31-15-19-4-2-1-3-5-19/h1-13H,14-17H2,(H,26,27)(H2,25,29,30) |
| InChIKey | FGKKGQMWUMBVEM-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 134.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.53 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |