C26H34N2O7S — CID 16503896
[2-[5-(dimethylsulfamoyl)-2-methylanilino]-2-oxoethyl] 4-oxo-4-(4-pentoxyphenyl)butanoate (PubChem CID 16503896) has the molecular formula C26H34N2O7S and a molecular weight of 518.63 g/mol. Its IUPAC name is [2-[5-(dimethylsulfamoyl)-2-methylanilino]-2-oxoethyl] 4-oxo-4-(4-pentoxyphenyl)butanoate.
| Compound Name | [2-[5-(dimethylsulfamoyl)-2-methylanilino]-2-oxoethyl] 4-oxo-4-(4-pentoxyphenyl)butanoate |
|---|---|
| PubChem CID | 16503896 |
| Molecular Formula | C26H34N2O7S |
| Molecular Weight | 518.63 g/mol |
| Exact Mass | 518.21 |
| IUPAC Name | [2-[5-(dimethylsulfamoyl)-2-methylanilino]-2-oxoethyl] 4-oxo-4-(4-pentoxyphenyl)butanoate |
| SMILES | CCCCCOc1ccc(C(=O)CCC(=O)OCC(=O)Nc2cc(S(=O)(=O)N(C)C)ccc2C)cc1 |
| InChI | InChI=1S/C26H34N2O7S/c1-5-6-7-16-34-21-11-9-20(10-12-21)24(29)14-15-26(31)35-18-25(30)27-23-17-22(13-8-19(23)2)36(32,33)28(3)4/h8-13,17H,5-7,14-16,18H2,1-4H3,(H,27,30) |
| InChIKey | SEZZQOTYLDJJQX-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.63 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|