C26H29NO8 — CID 42980702
[2-[(6-acetyl-1,3-benzodioxol-5-yl)amino]-2-oxoethyl] 4-oxo-4-(4-pentoxyphenyl)butanoate (PubChem CID 42980702) has the molecular formula C26H29NO8 and a molecular weight of 483.52 g/mol. Its IUPAC name is [2-[(6-acetyl-1,3-benzodioxol-5-yl)amino]-2-oxoethyl] 4-oxo-4-(4-pentoxyphenyl)butanoate.
| Compound Name | [2-[(6-acetyl-1,3-benzodioxol-5-yl)amino]-2-oxoethyl] 4-oxo-4-(4-pentoxyphenyl)butanoate |
|---|---|
| PubChem CID | 42980702 |
| Molecular Formula | C26H29NO8 |
| Molecular Weight | 483.52 g/mol |
| Exact Mass | 483.19 |
| IUPAC Name | [2-[(6-acetyl-1,3-benzodioxol-5-yl)amino]-2-oxoethyl] 4-oxo-4-(4-pentoxyphenyl)butanoate |
| SMILES | CCCCCOc1ccc(C(=O)CCC(=O)OCC(=O)Nc2cc3c(cc2C(C)=O)OCO3)cc1 |
| InChI | InChI=1S/C26H29NO8/c1-3-4-5-12-32-19-8-6-18(7-9-19)22(29)10-11-26(31)33-15-25(30)27-21-14-24-23(34-16-35-24)13-20(21)17(2)28/h6-9,13-14H,3-5,10-12,15-16H2,1-2H3,(H,27,30) |
| InChIKey | BSYRMYHLXZMUHE-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 117.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.52 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|