C19H20N2O5 — CID 119618979
N-(6-amino-1,3-benzodioxol-5-yl)-4-(4-ethoxyphenyl)-4-oxobutanamide (PubChem CID 119618979) has the molecular formula C19H20N2O5 and a molecular weight of 356.38 g/mol. Its IUPAC name is N-(6-amino-1,3-benzodioxol-5-yl)-4-(4-ethoxyphenyl)-4-oxobutanamide.
| Compound Name | N-(6-amino-1,3-benzodioxol-5-yl)-4-(4-ethoxyphenyl)-4-oxobutanamide |
|---|---|
| PubChem CID | 119618979 |
| Molecular Formula | C19H20N2O5 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | N-(6-amino-1,3-benzodioxol-5-yl)-4-(4-ethoxyphenyl)-4-oxobutanamide |
| SMILES | CCOc1ccc(C(=O)CCC(=O)Nc2cc3c(cc2N)OCO3)cc1 |
| InChI | InChI=1S/C19H20N2O5/c1-2-24-13-5-3-12(4-6-13)16(22)7-8-19(23)21-15-10-18-17(9-14(15)20)25-11-26-18/h3-6,9-10H,2,7-8,11,20H2,1H3,(H,21,23) |
| InChIKey | OIGDQXUQDVIBTG-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|