C20H25ClN2O5 — CID 119618195
N-(6-amino-1,3-benzodioxol-5-yl)-4-[4-(2-methoxyethyl)phenoxy]butanamide;hydrochloride (PubChem CID 119618195) has the molecular formula C20H25ClN2O5 and a molecular weight of 408.88 g/mol. Its IUPAC name is N-(6-amino-1,3-benzodioxol-5-yl)-4-[4-(2-methoxyethyl)phenoxy]butanamide;hydrochloride.
| Compound Name | N-(6-amino-1,3-benzodioxol-5-yl)-4-[4-(2-methoxyethyl)phenoxy]butanamide;hydrochloride |
|---|---|
| PubChem CID | 119618195 |
| Molecular Formula | C20H25ClN2O5 |
| Molecular Weight | 408.88 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | N-(6-amino-1,3-benzodioxol-5-yl)-4-[4-(2-methoxyethyl)phenoxy]butanamide;hydrochloride |
| SMILES | COCCc1ccc(OCCCC(=O)Nc2cc3c(cc2N)OCO3)cc1.Cl |
| InChI | InChI=1S/C20H24N2O5.ClH/c1-24-10-8-14-4-6-15(7-5-14)25-9-2-3-20(23)22-17-12-19-18(11-16(17)21)26-13-27-19;/h4-7,11-12H,2-3,8-10,13,21H2,1H3,(H,22,23);1H |
| InChIKey | PJDYTAIMFZKWHJ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 92.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.88 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|