C16H24ClN3O4 — CID 119618173
N-(6-amino-1,3-benzodioxol-5-yl)-N',N'-diethylpentanediamide;hydrochloride (PubChem CID 119618173) has the molecular formula C16H24ClN3O4 and a molecular weight of 357.84 g/mol. Its IUPAC name is N-(6-amino-1,3-benzodioxol-5-yl)-N',N'-diethylpentanediamide;hydrochloride.
| Compound Name | N-(6-amino-1,3-benzodioxol-5-yl)-N',N'-diethylpentanediamide;hydrochloride |
|---|---|
| PubChem CID | 119618173 |
| Molecular Formula | C16H24ClN3O4 |
| Molecular Weight | 357.84 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | N-(6-amino-1,3-benzodioxol-5-yl)-N',N'-diethylpentanediamide;hydrochloride |
| SMILES | CCN(CC)C(=O)CCCC(=O)Nc1cc2c(cc1N)OCO2.Cl |
| InChI | InChI=1S/C16H23N3O4.ClH/c1-3-19(4-2)16(21)7-5-6-15(20)18-12-9-14-13(8-11(12)17)22-10-23-14;/h8-9H,3-7,10,17H2,1-2H3,(H,18,20);1H |
| InChIKey | YCBUOVYMBZDRKF-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.84 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|