C16H24ClN3O4 — CID 119618559
N-[4-[(6-amino-1,3-benzodioxol-5-yl)amino]-4-oxobutyl]-2,2-dimethylpropanamide;hydrochloride (PubChem CID 119618559) has the molecular formula C16H24ClN3O4 and a molecular weight of 357.84 g/mol. Its IUPAC name is N-[4-[(6-amino-1,3-benzodioxol-5-yl)amino]-4-oxobutyl]-2,2-dimethylpropanamide;hydrochloride.
| Compound Name | N-[4-[(6-amino-1,3-benzodioxol-5-yl)amino]-4-oxobutyl]-2,2-dimethylpropanamide;hydrochloride |
|---|---|
| PubChem CID | 119618559 |
| Molecular Formula | C16H24ClN3O4 |
| Molecular Weight | 357.84 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | N-[4-[(6-amino-1,3-benzodioxol-5-yl)amino]-4-oxobutyl]-2,2-dimethylpropanamide;hydrochloride |
| SMILES | CC(C)(C)C(=O)NCCCC(=O)Nc1cc2c(cc1N)OCO2.Cl |
| InChI | InChI=1S/C16H23N3O4.ClH/c1-16(2,3)15(21)18-6-4-5-14(20)19-11-8-13-12(7-10(11)17)22-9-23-13;/h7-8H,4-6,9,17H2,1-3H3,(H,18,21)(H,19,20);1H |
| InChIKey | DWUPJWACKFCMMG-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.84 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|