C20H24N2O3 — CID 119618243
N-(6-amino-1,3-benzodioxol-5-yl)-3-(4-tert-butylphenyl)propanamide (PubChem CID 119618243) has the molecular formula C20H24N2O3 and a molecular weight of 340.42 g/mol. Its IUPAC name is N-(6-amino-1,3-benzodioxol-5-yl)-3-(4-tert-butylphenyl)propanamide.
| Compound Name | N-(6-amino-1,3-benzodioxol-5-yl)-3-(4-tert-butylphenyl)propanamide |
|---|---|
| PubChem CID | 119618243 |
| Molecular Formula | C20H24N2O3 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | N-(6-amino-1,3-benzodioxol-5-yl)-3-(4-tert-butylphenyl)propanamide |
| SMILES | CC(C)(C)c1ccc(CCC(=O)Nc2cc3c(cc2N)OCO3)cc1 |
| InChI | InChI=1S/C20H24N2O3/c1-20(2,3)14-7-4-13(5-8-14)6-9-19(23)22-16-11-18-17(10-15(16)21)24-12-25-18/h4-5,7-8,10-11H,6,9,12,21H2,1-3H3,(H,22,23) |
| InChIKey | GIVUXLKLRXDNPX-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|