C18H20N2O3 — CID 119618103
N-(6-amino-1,3-benzodioxol-5-yl)-3-(2,4-dimethylphenyl)propanamide (PubChem CID 119618103) has the molecular formula C18H20N2O3 and a molecular weight of 312.37 g/mol. Its IUPAC name is N-(6-amino-1,3-benzodioxol-5-yl)-3-(2,4-dimethylphenyl)propanamide.
| Compound Name | N-(6-amino-1,3-benzodioxol-5-yl)-3-(2,4-dimethylphenyl)propanamide |
|---|---|
| PubChem CID | 119618103 |
| Molecular Formula | C18H20N2O3 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | N-(6-amino-1,3-benzodioxol-5-yl)-3-(2,4-dimethylphenyl)propanamide |
| SMILES | Cc1ccc(CCC(=O)Nc2cc3c(cc2N)OCO3)c(C)c1 |
| InChI | InChI=1S/C18H20N2O3/c1-11-3-4-13(12(2)7-11)5-6-18(21)20-15-9-17-16(8-14(15)19)22-10-23-17/h3-4,7-9H,5-6,10,19H2,1-2H3,(H,20,21) |
| InChIKey | BGKDFJARHOCEDI-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|