C19H22ClN3O4 — CID 119618839
3-acetamido-N-(6-amino-1,3-benzodioxol-5-yl)-3-(4-methylphenyl)propanamide;hydrochloride (PubChem CID 119618839) has the molecular formula C19H22ClN3O4 and a molecular weight of 391.86 g/mol. Its IUPAC name is 3-acetamido-N-(6-amino-1,3-benzodioxol-5-yl)-3-(4-methylphenyl)propanamide;hydrochloride.
| Compound Name | 3-acetamido-N-(6-amino-1,3-benzodioxol-5-yl)-3-(4-methylphenyl)propanamide;hydrochloride |
|---|---|
| PubChem CID | 119618839 |
| Molecular Formula | C19H22ClN3O4 |
| Molecular Weight | 391.86 g/mol |
| Exact Mass | 391.13 |
| IUPAC Name | 3-acetamido-N-(6-amino-1,3-benzodioxol-5-yl)-3-(4-methylphenyl)propanamide;hydrochloride |
| SMILES | CC(=O)NC(CC(=O)Nc1cc2c(cc1N)OCO2)c1ccc(C)cc1.Cl |
| InChI | InChI=1S/C19H21N3O4.ClH/c1-11-3-5-13(6-4-11)15(21-12(2)23)9-19(24)22-16-8-18-17(7-14(16)20)25-10-26-18;/h3-8,15H,9-10,20H2,1-2H3,(H,21,23)(H,22,24);1H |
| InChIKey | TWPHKBGMZYHQEG-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.86 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|